C20H25N4O3S+ — CID 9228522
(4-pyridin-1-ium-4-ylpiperazin-1-yl)-(4-pyrrolidin-1-ylsulfonylphenyl)methanone (PubChem CID 9228522) has the molecular formula C20H25N4O3S+ and a molecular weight of 401.51 g/mol. Its IUPAC name is (4-pyridin-1-ium-4-ylpiperazin-1-yl)-(4-pyrrolidin-1-ylsulfonylphenyl)methanone.
| Compound Name | (4-pyridin-1-ium-4-ylpiperazin-1-yl)-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 9228522 |
| Molecular Formula | C20H25N4O3S+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (4-pyridin-1-ium-4-ylpiperazin-1-yl)-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCC2)cc1)N1CCN(c2cc[nH+]cc2)CC1 |
| InChI | InChI=1S/C20H24N4O3S/c25-20(23-15-13-22(14-16-23)18-7-9-21-10-8-18)17-3-5-19(6-4-17)28(26,27)24-11-1-2-12-24/h3-10H,1-2,11-16H2/p+1 |
| InChIKey | JMGFYPVLTMTVJL-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 75.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |