C22H25N3O5S — CID 55646192
[4-(2-hydroxybenzoyl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone (PubChem CID 55646192) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is [4-(2-hydroxybenzoyl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone.
| Compound Name | [4-(2-hydroxybenzoyl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 55646192 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [4-(2-hydroxybenzoyl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCC2)cc1)N1CCN(C(=O)c2ccccc2O)CC1 |
| InChI | InChI=1S/C22H25N3O5S/c26-20-6-2-1-5-19(20)22(28)24-15-13-23(14-16-24)21(27)17-7-9-18(10-8-17)31(29,30)25-11-3-4-12-25/h1-2,5-10,26H,3-4,11-16H2 |
| InChIKey | RDULSLDZUDJHRB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |