C19H22BrN5O3S — CID 46455043
[4-(5-bromopyrimidin-2-yl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone (PubChem CID 46455043) has the molecular formula C19H22BrN5O3S and a molecular weight of 480.39 g/mol. Its IUPAC name is [4-(5-bromopyrimidin-2-yl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone.
| Compound Name | [4-(5-bromopyrimidin-2-yl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 46455043 |
| Molecular Formula | C19H22BrN5O3S |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | [4-(5-bromopyrimidin-2-yl)piperazin-1-yl]-(4-pyrrolidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCC2)cc1)N1CCN(c2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C19H22BrN5O3S/c20-16-13-21-19(22-14-16)24-11-9-23(10-12-24)18(26)15-3-5-17(6-4-15)29(27,28)25-7-1-2-8-25/h3-6,13-14H,1-2,7-12H2 |
| InChIKey | XWBWJTIJVZMDCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |