C26H27N3O4S2 — CID 89238001
N-[4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4-phenylthiophene-2-carboxamide (PubChem CID 89238001) has the molecular formula C26H27N3O4S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is N-[4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 89238001 |
| Molecular Formula | C26H27N3O4S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4-phenylthiophene-2-carboxamide |
| SMILES | C=CC(=O)NC1(C)CCN(S(=O)(=O)c2ccc(NC(=O)c3cc(-c4ccccc4)cs3)cc2)CC1 |
| InChI | InChI=1S/C26H27N3O4S2/c1-3-24(30)28-26(2)13-15-29(16-14-26)35(32,33)22-11-9-21(10-12-22)27-25(31)23-17-20(18-34-23)19-7-5-4-6-8-19/h3-12,17-18H,1,13-16H2,2H3,(H,27,31)(H,28,30) |
| InChIKey | MQHMPMRNNUTVJB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|