C20H24N4O4S — CID 89236888
N-[4-methyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 89236888) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[4-methyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[4-methyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236888 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[4-methyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1(C)CCN(S(=O)(=O)c2cccc(Oc3cncc(C)n3)c2)CC1 |
| InChI | InChI=1S/C20H24N4O4S/c1-4-18(25)23-20(3)8-10-24(11-9-20)29(26,27)17-7-5-6-16(12-17)28-19-14-21-13-15(2)22-19/h4-7,12-14H,1,8-11H2,2-3H3,(H,23,25) |
| InChIKey | MAHRRFDKRLGXFT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|