C19H20N4O4S — CID 89235902
N-[3-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide (PubChem CID 89235902) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[3-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide.
| Compound Name | N-[3-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89235902 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[3-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C2CN(S(=O)(=O)c3cccc(Oc4cncc(C)n4)c3)CC21 |
| InChI | InChI=1S/C19H20N4O4S/c1-3-17(24)22-19-15-10-23(11-16(15)19)28(25,26)14-6-4-5-13(7-14)27-18-9-20-8-12(2)21-18/h3-9,15-16,19H,1,10-11H2,2H3,(H,22,24) |
| InChIKey | RSKTUVNZSFCJIK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|