C20H23N3O4S — CID 89236222
N-[1-[(6-phenoxy-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide (PubChem CID 89236222) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[1-[(6-phenoxy-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide.
| Compound Name | N-[1-[(6-phenoxy-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236222 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[1-[(6-phenoxy-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCN(S(=O)(=O)c2ccc(Oc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C20H23N3O4S/c1-2-19(24)22-16-8-6-7-13-23(15-16)28(25,26)18-11-12-20(21-14-18)27-17-9-4-3-5-10-17/h2-5,9-12,14,16H,1,6-8,13,15H2,(H,22,24) |
| InChIKey | VUSJETPTPVHGPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|