C19H25N3O4S — CID 89239014
N-methyl-N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide (PubChem CID 89239014) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-methyl-N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide.
| Compound Name | N-methyl-N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 89239014 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-methyl-N-[4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(S(=O)(=O)c2ccc(N(C)C(=O)C3CC3)cc2)C1 |
| InChI | InChI=1S/C19H25N3O4S/c1-3-18(23)20-15-5-4-12-22(13-15)27(25,26)17-10-8-16(9-11-17)21(2)19(24)14-6-7-14/h3,8-11,14-15H,1,4-7,12-13H2,2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | QSSOBXICKSYOLR-HNNXBMFYSA-N |
| XLogP | 1.51 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|