C21H27N3O5S — CID 89238203
N-methyl-N-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]oxane-4-carboxamide (PubChem CID 89238203) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-methyl-N-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]oxane-4-carboxamide.
| Compound Name | N-methyl-N-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 89238203 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-methyl-N-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]oxane-4-carboxamide |
| SMILES | C=CC(=O)NC1C2CN(S(=O)(=O)c3ccc(N(C)C(=O)C4CCOCC4)cc3)CC21 |
| InChI | InChI=1S/C21H27N3O5S/c1-3-19(25)22-20-17-12-24(13-18(17)20)30(27,28)16-6-4-15(5-7-16)23(2)21(26)14-8-10-29-11-9-14/h3-7,14,17-18,20H,1,8-13H2,2H3,(H,22,25) |
| InChIKey | RABBFEVVTYWCIG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|