C21H29N3O4S — CID 89238281
N-[4-[2,6-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-N-methylcyclopropanecarboxamide (PubChem CID 89238281) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[4-[2,6-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[4-[2,6-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 89238281 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[4-[2,6-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-N-methylcyclopropanecarboxamide |
| SMILES | C=CC(=O)NC1CC(C)N(S(=O)(=O)c2ccc(N(C)C(=O)C3CC3)cc2)C(C)C1 |
| InChI | InChI=1S/C21H29N3O4S/c1-5-20(25)22-17-12-14(2)24(15(3)13-17)29(27,28)19-10-8-18(9-11-19)23(4)21(26)16-6-7-16/h5,8-11,14-17H,1,6-7,12-13H2,2-4H3,(H,22,25) |
| InChIKey | LTTKIHLIUVEUOU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|