C27H38N4O5S — CID 89237010
N-[2,6-dimethyl-1-[4-[4-(pyrrolidine-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 89237010) has the molecular formula C27H38N4O5S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[2,6-dimethyl-1-[4-[4-(pyrrolidine-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[2,6-dimethyl-1-[4-[4-(pyrrolidine-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237010 |
| Molecular Formula | C27H38N4O5S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-[2,6-dimethyl-1-[4-[4-(pyrrolidine-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(C)N(S(=O)(=O)c2ccc(C(=O)N3CCC(C(=O)N4CCCC4)CC3)cc2)C(C)C1 |
| InChI | InChI=1S/C27H38N4O5S/c1-4-25(32)28-23-17-19(2)31(20(3)18-23)37(35,36)24-9-7-21(8-10-24)26(33)30-15-11-22(12-16-30)27(34)29-13-5-6-14-29/h4,7-10,19-20,22-23H,1,5-6,11-18H2,2-3H3,(H,28,32) |
| InChIKey | GNGOMEWQSDTXOA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|