C21H26N4O4S — CID 89238967
N-[2,6-dimethyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 89238967) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[2,6-dimethyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[2,6-dimethyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238967 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[2,6-dimethyl-1-[3-(6-methylpyrazin-2-yl)oxyphenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(C)N(S(=O)(=O)c2cccc(Oc3cncc(C)n3)c2)C(C)C1 |
| InChI | InChI=1S/C21H26N4O4S/c1-5-20(26)24-17-9-15(3)25(16(4)10-17)30(27,28)19-8-6-7-18(11-19)29-21-13-22-12-14(2)23-21/h5-8,11-13,15-17H,1,9-10H2,2-4H3,(H,24,26) |
| InChIKey | RDOPZTCHMOKVHE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|