C23H25N3O5S — CID 89239193
[2-phenyl-1-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]ethyl]carbamic acid (PubChem CID 89239193) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is [2-phenyl-1-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]ethyl]carbamic acid.
| Compound Name | [2-phenyl-1-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 89239193 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [2-phenyl-1-[4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]phenyl]ethyl]carbamic acid |
| SMILES | C=CC(=O)NC1C2CN(S(=O)(=O)c3ccc(C(Cc4ccccc4)NC(=O)O)cc3)CC21 |
| InChI | InChI=1S/C23H25N3O5S/c1-2-21(27)25-22-18-13-26(14-19(18)22)32(30,31)17-10-8-16(9-11-17)20(24-23(28)29)12-15-6-4-3-5-7-15/h2-11,18-20,22,24H,1,12-14H2,(H,25,27)(H,28,29) |
| InChIKey | BCRWKFIZASSHKN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|