C24H23N3O6S — CID 89238579
[2-phenyl-1-[4-[[2-(prop-2-enoylamino)-4,6-dihydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]ethyl]carbamic acid (PubChem CID 89238579) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is [2-phenyl-1-[4-[[2-(prop-2-enoylamino)-4,6-dihydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]ethyl]carbamic acid.
| Compound Name | [2-phenyl-1-[4-[[2-(prop-2-enoylamino)-4,6-dihydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 89238579 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | [2-phenyl-1-[4-[[2-(prop-2-enoylamino)-4,6-dihydrofuro[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]ethyl]carbamic acid |
| SMILES | C=CC(=O)Nc1cc2c(o1)CN(S(=O)(=O)c1ccc(C(Cc3ccccc3)NC(=O)O)cc1)C2 |
| InChI | InChI=1S/C24H23N3O6S/c1-2-22(28)26-23-13-18-14-27(15-21(18)33-23)34(31,32)19-10-8-17(9-11-19)20(25-24(29)30)12-16-6-4-3-5-7-16/h2-11,13,20,25H,1,12,14-15H2,(H,26,28)(H,29,30) |
| InChIKey | MGFUBFMMOCEECL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|