C20H17N3O5S2 — CID 89238723
N-[4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]furan-2-carboxamide (PubChem CID 89238723) has the molecular formula C20H17N3O5S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 89238723 |
| Molecular Formula | C20H17N3O5S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]furan-2-carboxamide |
| SMILES | C=CC(=O)Nc1cc2c(s1)CN(S(=O)(=O)c1ccc(NC(=O)c3ccco3)cc1)C2 |
| InChI | InChI=1S/C20H17N3O5S2/c1-2-18(24)22-19-10-13-11-23(12-17(13)29-19)30(26,27)15-7-5-14(6-8-15)21-20(25)16-4-3-9-28-16/h2-10H,1,11-12H2,(H,21,25)(H,22,24) |
| InChIKey | QBCRHOOCXPKZPD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|