C15H13N3O5S2 — CID 89237131
N-[5-(4-nitrophenyl)sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89237131) has the molecular formula C15H13N3O5S2 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[5-(4-nitrophenyl)sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-(4-nitrophenyl)sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237131 |
| Molecular Formula | C15H13N3O5S2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[5-(4-nitrophenyl)sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(s1)CN(S(=O)(=O)c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C15H13N3O5S2/c1-2-14(19)16-15-7-10-8-17(9-13(10)24-15)25(22,23)12-5-3-11(4-6-12)18(20)21/h2-7H,1,8-9H2,(H,16,19) |
| InChIKey | HDHKHGGZPRWHHJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|