C12H10N4O4S — CID 90585464
6-(4-nitrophenyl)sulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine (PubChem CID 90585464) has the molecular formula C12H10N4O4S and a molecular weight of 306.30 g/mol. Its IUPAC name is 6-(4-nitrophenyl)sulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine.
| Compound Name | 6-(4-nitrophenyl)sulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 90585464 |
| Molecular Formula | C12H10N4O4S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 6-(4-nitrophenyl)sulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2Cc3cncnc3C2)cc1 |
| InChI | InChI=1S/C12H10N4O4S/c17-16(18)10-1-3-11(4-2-10)21(19,20)15-6-9-5-13-8-14-12(9)7-15/h1-5,8H,6-7H2 |
| InChIKey | BZCNIAIUKFRYRX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|