C17H16N2O4S — CID 101053011
1-(4-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 101053011) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(4-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 101053011 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-(4-nitrophenyl)sulfonyl-5-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC=C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c20-19(21)16-8-10-17(11-9-16)24(22,23)18-12-4-7-15(13-18)14-5-2-1-3-6-14/h1-3,5-11H,4,12-13H2 |
| InChIKey | RVBCDSAMOMUTFE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|