C21H23N5O6S2 — CID 19684923
1-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine (PubChem CID 19684923) has the molecular formula C21H23N5O6S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine.
| Compound Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 19684923 |
| Molecular Formula | C21H23N5O6S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H23N5O6S2/c1-16-21(17(2)25(22-16)18-6-4-3-5-7-18)34(31,32)24-14-12-23(13-15-24)33(29,30)20-10-8-19(9-11-20)26(27)28/h3-11H,12-15H2,1-2H3 |
| InChIKey | ADJJLNPOXRRUDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|