C21H23N5O5S — CID 17402532
3,5-dimethyl-N-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-1-phenylpyrazol-4-amine (PubChem CID 17402532) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-1-phenylpyrazol-4-amine.
| Compound Name | 3,5-dimethyl-N-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-1-phenylpyrazol-4-amine |
|---|---|
| PubChem CID | 17402532 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 3,5-dimethyl-N-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)-1-phenylpyrazol-4-amine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1Nc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N5O5S/c1-15-21(16(2)25(23-15)17-6-4-3-5-7-17)22-19-9-8-18(14-20(19)26(27)28)32(29,30)24-10-12-31-13-11-24/h3-9,14,22H,10-13H2,1-2H3 |
| InChIKey | RXAWQDQXRUJSSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|