C24H30N6O4S — CID 29108272
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 29108272) has the molecular formula C24H30N6O4S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 29108272 |
| Molecular Formula | C24H30N6O4S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)c1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H30N6O4S/c1-18-22(19(2)29(25-18)20-8-6-5-7-9-20)17-27(4)23-11-10-21(16-24(23)30(31)32)35(33,34)28-14-12-26(3)13-15-28/h5-11,16H,12-15,17H2,1-4H3 |
| InChIKey | CQFRDPHMSUERQR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|