C16H23N5O4S — CID 95785250
(3S)-3-[N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroanilino]butanenitrile (PubChem CID 95785250) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is (3S)-3-[N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroanilino]butanenitrile.
| Compound Name | (3S)-3-[N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroanilino]butanenitrile |
|---|---|
| PubChem CID | 95785250 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (3S)-3-[N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroanilino]butanenitrile |
| SMILES | C[C@@H](CC#N)N(C)c1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N5O4S/c1-13(6-7-17)19(3)15-5-4-14(12-16(15)21(22)23)26(24,25)20-10-8-18(2)9-11-20/h4-5,12-13H,6,8-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | OWILEYAJFARSLE-ZDUSSCGKSA-N |
| XLogP | 1.27 |
| TPSA | 110.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|