C13H20N4O6S2 — CID 37225286
N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-3-nitrobenzenesulfonamide (PubChem CID 37225286) has the molecular formula C13H20N4O6S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-3-nitrobenzenesulfonamide.
| Compound Name | N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 37225286 |
| Molecular Formula | C13H20N4O6S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-3-nitrobenzenesulfonamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N(C)C)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H20N4O6S2/c1-14(2)24(20,21)11-4-5-13(12(10-11)17(18)19)25(22,23)16-8-6-15(3)7-9-16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | GVWWZRKPAKPZAI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|