C19H24FN4O4S+ — CID 9183758
N-[(4-fluorophenyl)methyl]-N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitroaniline (PubChem CID 9183758) has the molecular formula C19H24FN4O4S+ and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 9183758 |
| Molecular Formula | C19H24FN4O4S+ |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonyl-2-nitroaniline |
| SMILES | CN(Cc1ccc(F)cc1)c1ccc(S(=O)(=O)N2CC[NH+](C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23FN4O4S/c1-21-9-11-23(12-10-21)29(27,28)17-7-8-18(19(13-17)24(25)26)22(2)14-15-3-5-16(20)6-4-15/h3-8,13H,9-12,14H2,1-2H3/p+1 |
| InChIKey | BJIJZRZAPAKAIK-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|