C21H23ClN4O2S — CID 90507181
1-(4-chlorophenyl)sulfonyl-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazine (PubChem CID 90507181) has the molecular formula C21H23ClN4O2S and a molecular weight of 430.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazine |
|---|---|
| PubChem CID | 90507181 |
| Molecular Formula | C21H23ClN4O2S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H23ClN4O2S/c1-16-21(17(2)26(23-16)19-6-4-3-5-7-19)24-12-14-25(15-13-24)29(27,28)20-10-8-18(22)9-11-20/h3-11H,12-15H2,1-2H3 |
| InChIKey | NJQPYUPQLREUOT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |