C15H14N2O3S2 — CID 91027363
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 91027363) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 91027363 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)Nc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C15H14N2O3S2/c18-14(16-15-8-10-2-1-3-13(10)22-15)9-21-12-6-4-11(5-7-12)17(19)20/h4-8H,1-3,9H2,(H,16,18) |
| InChIKey | DISWOSRQYCFPSD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|