C17H14N4O3S2 — CID 16547326
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 16547326) has the molecular formula C17H14N4O3S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 16547326 |
| Molecular Formula | C17H14N4O3S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)Nc1nnc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C17H14N4O3S2/c22-15(11-25-14-8-6-13(7-9-14)21(23)24)18-17-20-19-16(26-17)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,20,22) |
| InChIKey | WGZKFUFSPLHRHF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|