C16H13N3O4S3 — CID 89238383
N-[5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89238383) has the molecular formula C16H13N3O4S3 and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238383 |
| Molecular Formula | C16H13N3O4S3 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-[5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]sulfonyl-4,6-dihydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(s1)CN(S(=O)(=O)c1ccc(-c3cnco3)s1)C2 |
| InChI | InChI=1S/C16H13N3O4S3/c1-2-14(20)18-15-5-10-7-19(8-13(10)24-15)26(21,22)16-4-3-12(25-16)11-6-17-9-23-11/h2-6,9H,1,7-8H2,(H,18,20) |
| InChIKey | YBWYFAFSDQMTIV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|