C16H19N3O4S2 — CID 89238361
N-[1-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylazepan-3-yl]prop-2-enamide (PubChem CID 89238361) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[1-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylazepan-3-yl]prop-2-enamide.
| Compound Name | N-[1-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylazepan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238361 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[1-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylazepan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCN(S(=O)(=O)c2ccc(-c3ccno3)s2)C1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-2-15(20)18-12-5-3-4-10-19(11-12)25(21,22)16-7-6-14(24-16)13-8-9-17-23-13/h2,6-9,12H,1,3-5,10-11H2,(H,18,20) |
| InChIKey | IRFCWYHVLRTMBN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|