C18H26N4O4S — CID 89236153
N-[1-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide (PubChem CID 89236153) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[1-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide.
| Compound Name | N-[1-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236153 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[1-[(6-morpholin-4-yl-3-pyridinyl)sulfonyl]azepan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCN(S(=O)(=O)c2ccc(N3CCOCC3)nc2)C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-2-18(23)20-15-5-3-4-8-22(14-15)27(24,25)16-6-7-17(19-13-16)21-9-11-26-12-10-21/h2,6-7,13,15H,1,3-5,8-12,14H2,(H,20,23) |
| InChIKey | NTWMYRQIFASFOX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|