C16H24N4O5S — CID 174214991
[4-[(6-morpholin-4-yl-3-pyridinyl)sulfonylamino]cyclohexyl]carbamic acid (PubChem CID 174214991) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is [4-[(6-morpholin-4-yl-3-pyridinyl)sulfonylamino]cyclohexyl]carbamic acid.
| Compound Name | [4-[(6-morpholin-4-yl-3-pyridinyl)sulfonylamino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174214991 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [4-[(6-morpholin-4-yl-3-pyridinyl)sulfonylamino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(NS(=O)(=O)c2ccc(N3CCOCC3)nc2)CC1 |
| InChI | InChI=1S/C16H24N4O5S/c21-16(22)18-12-1-3-13(4-2-12)19-26(23,24)14-5-6-15(17-11-14)20-7-9-25-10-8-20/h5-6,11-13,18-19H,1-4,7-10H2,(H,21,22) |
| InChIKey | BSLRWQRUHBNLNR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |