C20H33N5O3S — CID 55816286
N-cyclopropyl-2-[4-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperazin-1-yl]propanamide (PubChem CID 55816286) has the molecular formula C20H33N5O3S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperazin-1-yl]propanamide.
| Compound Name | N-cyclopropyl-2-[4-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55816286 |
| Molecular Formula | C20H33N5O3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-cyclopropyl-2-[4-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperazin-1-yl]propanamide |
| SMILES | CCC(CC)NS(=O)(=O)c1ccc(N2CCN(C(C)C(=O)NC3CC3)CC2)nc1 |
| InChI | InChI=1S/C20H33N5O3S/c1-4-16(5-2)23-29(27,28)18-8-9-19(21-14-18)25-12-10-24(11-13-25)15(3)20(26)22-17-6-7-17/h8-9,14-17,23H,4-7,10-13H2,1-3H3,(H,22,26) |
| InChIKey | ROOWHCJITMJOAR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |