C17H22F3N3O3S — CID 8710306
(2R)-N-cyclopropyl-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide (PubChem CID 8710306) has the molecular formula C17H22F3N3O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8710306 |
| Molecular Formula | C17H22F3N3O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC1CC1)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H22F3N3O3S/c1-12(16(24)21-14-4-5-14)22-8-10-23(11-9-22)27(25,26)15-6-2-13(3-7-15)17(18,19)20/h2-3,6-7,12,14H,4-5,8-11H2,1H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | ABVIMPYHGHGWAZ-GFCCVEGCSA-N |
| XLogP | 1.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |