C24H32F3N3O3S — CID 25479743
(2S)-N-(1-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide (PubChem CID 25479743) has the molecular formula C24H32F3N3O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(1-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 25479743 |
| Molecular Formula | C24H32F3N3O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | (2S)-N-(1-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC12CC3CC(CC(C3)C1)C2)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H32F3N3O3S/c1-16(22(31)28-23-13-17-10-18(14-23)12-19(11-17)15-23)29-6-8-30(9-7-29)34(32,33)21-4-2-20(3-5-21)24(25,26)27/h2-5,16-19H,6-15H2,1H3,(H,28,31)/t16-,17?,18?,19?,23?/m0/s1 |
| InChIKey | ZKGMKXHEXNVUNR-LXGFQCHUSA-N |
| XLogP | 3.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |