C15H19F3N2O5S2 — CID 55699558
2-methylsulfonyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 55699558) has the molecular formula C15H19F3N2O5S2 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-methylsulfonyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-methylsulfonyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55699558 |
| Molecular Formula | C15H19F3N2O5S2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-methylsulfonyl-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | CC(C(=O)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H19F3N2O5S2/c1-11(26(2,22)23)14(21)19-7-9-20(10-8-19)27(24,25)13-5-3-12(4-6-13)15(16,17)18/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | MAFKVHPLKWIIOP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |