C15H20F3N3O2S2 — CID 8726849
N-propan-2-yl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbothioamide (PubChem CID 8726849) has the molecular formula C15H20F3N3O2S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-propan-2-yl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-propan-2-yl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8726849 |
| Molecular Formula | C15H20F3N3O2S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-propan-2-yl-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine-1-carbothioamide |
| SMILES | CC(C)NC(=S)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H20F3N3O2S2/c1-11(2)19-14(24)20-7-9-21(10-8-20)25(22,23)13-5-3-12(4-6-13)15(16,17)18/h3-6,11H,7-10H2,1-2H3,(H,19,24) |
| InChIKey | SEXJHEDCIVJJAF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|