C23H29F3N2O3S — CID 69085659
N-(1-adamantyl)-2-[1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]acetamide (PubChem CID 69085659) has the molecular formula C23H29F3N2O3S and a molecular weight of 470.56 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 69085659 |
| Molecular Formula | C23H29F3N2O3S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-(1-adamantyl)-2-[1-[4-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]acetamide |
| SMILES | O=C(CC1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29F3N2O3S/c24-23(25,26)19-1-3-20(4-2-19)32(30,31)28-6-5-15(14-28)10-21(29)27-22-11-16-7-17(12-22)9-18(8-16)13-22/h1-4,15-18H,5-14H2,(H,27,29) |
| InChIKey | GNNFYPOMWSMULI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |