C24H31F3N2O3S — CID 69082798
N-(1-adamantyl)-2-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]acetamide (PubChem CID 69082798) has the molecular formula C24H31F3N2O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 69082798 |
| Molecular Formula | C24H31F3N2O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-(1-adamantyl)-2-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-3-yl]acetamide |
| SMILES | O=C(CC1CCCN(S(=O)(=O)c2ccccc2C(F)(F)F)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31F3N2O3S/c25-24(26,27)20-5-1-2-6-21(20)33(31,32)29-7-3-4-16(15-29)11-22(30)28-23-12-17-8-18(13-23)10-19(9-17)14-23/h1-2,5-6,16-19H,3-4,7-15H2,(H,28,30) |
| InChIKey | ARFREUXQIYGXED-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |