C24H33N3O4S — CID 24959328
N'-[2-[1-(benzenesulfonyl)piperidin-3-yl]acetyl]adamantane-1-carbohydrazide (PubChem CID 24959328) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is N'-[2-[1-(benzenesulfonyl)piperidin-3-yl]acetyl]adamantane-1-carbohydrazide.
| Compound Name | N'-[2-[1-(benzenesulfonyl)piperidin-3-yl]acetyl]adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 24959328 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N'-[2-[1-(benzenesulfonyl)piperidin-3-yl]acetyl]adamantane-1-carbohydrazide |
| SMILES | O=C(CC1CCCN(S(=O)(=O)c2ccccc2)C1)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33N3O4S/c28-22(25-26-23(29)24-13-18-9-19(14-24)11-20(10-18)15-24)12-17-5-4-8-27(16-17)32(30,31)21-6-2-1-3-7-21/h1-3,6-7,17-20H,4-5,8-16H2,(H,25,28)(H,26,29) |
| InChIKey | NWEVBUVFHUBLHH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|