C18H26N2O5S2 — CID 91903755
3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 91903755) has the molecular formula C18H26N2O5S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 91903755 |
| Molecular Formula | C18H26N2O5S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-[1-(benzenesulfonyl)piperidin-3-yl]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | O=C(CCC1CCCN(S(=O)(=O)c2ccccc2)C1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26N2O5S2/c21-18(19-16-10-12-26(22,23)14-16)9-8-15-5-4-11-20(13-15)27(24,25)17-6-2-1-3-7-17/h1-3,6-7,15-16H,4-5,8-14H2,(H,19,21) |
| InChIKey | ICNMYSIEIDDLGH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |