C23H30F3N3O3S — CID 69084505
1-(1-adamantyl)-3-[[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]methyl]urea (PubChem CID 69084505) has the molecular formula C23H30F3N3O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 69084505 |
| Molecular Formula | C23H30F3N3O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-(1-adamantyl)-3-[[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]methyl]urea |
| SMILES | O=C(NCC1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30F3N3O3S/c24-23(25,26)19-2-1-3-20(9-19)33(31,32)29-5-4-15(14-29)13-27-21(30)28-22-10-16-6-17(11-22)8-18(7-16)12-22/h1-3,9,15-18H,4-8,10-14H2,(H2,27,28,30) |
| InChIKey | GCHGJDLORGFMJA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |