C16H22F3N3O4S — CID 76710604
1-butyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea (PubChem CID 76710604) has the molecular formula C16H22F3N3O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is 1-butyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea.
| Compound Name | 1-butyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea |
|---|---|
| PubChem CID | 76710604 |
| Molecular Formula | C16H22F3N3O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-butyl-3-[1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]oxyurea |
| SMILES | CCCCNC(=O)NOC1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H22F3N3O4S/c1-2-3-8-20-15(23)21-26-13-7-9-22(11-13)27(24,25)14-6-4-5-12(10-14)16(17,18)19/h4-6,10,13H,2-3,7-9,11H2,1H3,(H2,20,21,23) |
| InChIKey | CYQRAYRXTAYZSN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|