C14H16F3NO4S2 — CID 99982698
methyl 2-[(3S)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]sulfanylacetate (PubChem CID 99982698) has the molecular formula C14H16F3NO4S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl 2-[(3S)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]sulfanylacetate.
| Compound Name | methyl 2-[(3S)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 99982698 |
| Molecular Formula | C14H16F3NO4S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | methyl 2-[(3S)-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]sulfanylacetate |
| SMILES | COC(=O)CS[C@H]1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H16F3NO4S2/c1-22-13(19)9-23-11-5-6-18(8-11)24(20,21)12-4-2-3-10(7-12)14(15,16)17/h2-4,7,11H,5-6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | PIPJDTMVZYJGOI-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |