C23H27F3N2O3S — CID 42909030
N-(4-phenylbutan-2-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 42909030) has the molecular formula C23H27F3N2O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is N-(4-phenylbutan-2-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-phenylbutan-2-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 42909030 |
| Molecular Formula | C23H27F3N2O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-(4-phenylbutan-2-yl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H27F3N2O3S/c1-17(10-11-18-6-3-2-4-7-18)27-22(29)19-12-14-28(15-13-19)32(30,31)21-9-5-8-20(16-21)23(24,25)26/h2-9,16-17,19H,10-15H2,1H3,(H,27,29) |
| InChIKey | IUOCAUKDEHPGSS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |