C25H32N2O5S — CID 46612216
ethyl 4-[4-(4-phenylbutan-2-ylcarbamoyl)piperidin-1-yl]sulfonylbenzoate (PubChem CID 46612216) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is ethyl 4-[4-(4-phenylbutan-2-ylcarbamoyl)piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-(4-phenylbutan-2-ylcarbamoyl)piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 46612216 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | ethyl 4-[4-(4-phenylbutan-2-ylcarbamoyl)piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NC(C)CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O5S/c1-3-32-25(29)22-11-13-23(14-12-22)33(30,31)27-17-15-21(16-18-27)24(28)26-19(2)9-10-20-7-5-4-6-8-20/h4-8,11-14,19,21H,3,9-10,15-18H2,1-2H3,(H,26,28) |
| InChIKey | CDKFXBLNGNEGMQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |