C24H35N3O3S — CID 42633447
1-(1-adamantyl)-3-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]urea (PubChem CID 42633447) has the molecular formula C24H35N3O3S and a molecular weight of 445.63 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 42633447 |
| Molecular Formula | C24H35N3O3S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 1-(1-adamantyl)-3-[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]methyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(CNC(=O)NC34CC5CC(CC(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C24H35N3O3S/c1-17-2-4-22(5-3-17)31(29,30)27-8-6-18(7-9-27)16-25-23(28)26-24-13-19-10-20(14-24)12-21(11-19)15-24/h2-5,18-21H,6-16H2,1H3,(H2,25,26,28) |
| InChIKey | OKYYUANHRJWCMI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |