C24H33ClN4O2 — CID 69082258
4-[(1-adamantylcarbamoylamino)methyl]-N-(2-chlorophenyl)piperidine-1-carboxamide (PubChem CID 69082258) has the molecular formula C24H33ClN4O2 and a molecular weight of 445.01 g/mol. Its IUPAC name is 4-[(1-adamantylcarbamoylamino)methyl]-N-(2-chlorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[(1-adamantylcarbamoylamino)methyl]-N-(2-chlorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 69082258 |
| Molecular Formula | C24H33ClN4O2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-[(1-adamantylcarbamoylamino)methyl]-N-(2-chlorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(NCC1CCN(C(=O)Nc2ccccc2Cl)CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33ClN4O2/c25-20-3-1-2-4-21(20)27-23(31)29-7-5-16(6-8-29)15-26-22(30)28-24-12-17-9-18(13-24)11-19(10-17)14-24/h1-4,16-19H,5-15H2,(H,27,31)(H2,26,28,30) |
| InChIKey | VNIOWVSNMYNVBS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |