C17H30N3O+ — CID 28786562
1-(1-adamantyl)-3-(piperidin-1-ium-4-ylmethyl)urea (PubChem CID 28786562) has the molecular formula C17H30N3O+ and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(piperidin-1-ium-4-ylmethyl)urea.
| Compound Name | 1-(1-adamantyl)-3-(piperidin-1-ium-4-ylmethyl)urea |
|---|---|
| PubChem CID | 28786562 |
| Molecular Formula | C17H30N3O+ |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-(1-adamantyl)-3-(piperidin-1-ium-4-ylmethyl)urea |
| SMILES | O=C(NCC1CC[NH2+]CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H29N3O/c21-16(19-11-12-1-3-18-4-2-12)20-17-8-13-5-14(9-17)7-15(6-13)10-17/h12-15,18H,1-11H2,(H2,19,20,21)/p+1 |
| InChIKey | ZQMNKAGVCNSSIW-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 57.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |