C30H48N4O2 — CID 26974857
1-(1-adamantyl)-3-[[(1S,3S)-3-[(1-adamantylcarbamoylamino)methyl]cyclohexyl]methyl]urea (PubChem CID 26974857) has the molecular formula C30H48N4O2 and a molecular weight of 496.74 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[(1S,3S)-3-[(1-adamantylcarbamoylamino)methyl]cyclohexyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[(1S,3S)-3-[(1-adamantylcarbamoylamino)methyl]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 26974857 |
| Molecular Formula | C30H48N4O2 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | 1-(1-adamantyl)-3-[[(1S,3S)-3-[(1-adamantylcarbamoylamino)methyl]cyclohexyl]methyl]urea |
| SMILES | O=C(NC[C@H]1CCC[C@H](CNC(=O)NC23CC4CC(CC(C4)C2)C3)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H48N4O2/c35-27(33-29-11-21-5-22(12-29)7-23(6-21)13-29)31-17-19-2-1-3-20(4-19)18-32-28(36)34-30-14-24-8-25(15-30)10-26(9-24)16-30/h19-26H,1-18H2,(H2,31,33,35)(H2,32,34,36)/t19-,20-,21?,22?,23?,24?,25?,26?,29?,30?/m0/s1 |
| InChIKey | XVLOGMUOGIHPEJ-FBMKDOFISA-N |
| XLogP | 5.33 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |