C22H33N3O3S — CID 18196363
2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylpropanamide (PubChem CID 18196363) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is 2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylpropanamide.
| Compound Name | 2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 18196363 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-N-cyclopropylpropanamide |
| SMILES | CC(C(=O)NC1CC1)N1CCN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H33N3O3S/c1-17(22(26)23-20-9-10-20)24-13-15-25(16-14-24)29(27,28)21-11-7-19(8-12-21)18-5-3-2-4-6-18/h7-8,11-12,17-18,20H,2-6,9-10,13-16H2,1H3,(H,23,26) |
| InChIKey | PHVIEZLMSGBPTM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |